![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ~$ge-rank.doc | 2017-05-11 18:26 | 162 | |
| www9 paper_files/ | 2018-07-02 15:54 | - | |
| www9 paper.html | 2018-07-02 15:54 | 56K | |
| powerlaw_internet_to..> | 2018-07-02 15:54 | 451K | |
| pagerank_.svg | 2018-07-02 15:54 | 214K | |
| page-rank.doc | 2018-07-02 15:54 | 98K | |
| najork05_HITS_vs_sal..> | 2018-07-25 17:46 | 514K | |
| minhash.ppt | 2018-07-02 15:54 | 54K | |
| markov chains/ | 2018-07-02 15:54 | - | |
| intelligent_surfer_i..> | 2018-07-02 15:54 | 59K | |
| hypersearching_web.html | 2018-07-02 15:54 | 26K | |
| haveliwala02topicsen..> | 2018-07-02 15:54 | 260K | |
| The Structure of Inf..> | 2018-07-02 15:54 | 41K | |
| SALSA_topicPR_scan.pdf | 2018-07-02 15:54 | 1.5M | |
| SALSA.pdf | 2018-07-02 15:54 | 174K | |
| Pagerank Explained C..> | 2018-07-02 15:54 | - | |
| Pagerank Explained C..> | 2018-07-02 15:54 | 73K | |
| Markov_chains.pdf | 2020-02-24 12:08 | 13M | |
| KLINBERG_authoritati..> | 2018-07-02 15:54 | 256K | |