![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| KLINBERG_authoritati..> | 2015-07-02 15:45 | 256K | |
| Pagerank Explained C..> | 2015-07-02 15:45 | 73K | |
| page-rank.doc | 2015-07-02 15:45 | 98K | |
| Pagerank Explained C..> | 2015-07-02 15:45 | - | |
| IRLbot.pdf | 2018-07-02 15:54 | 732K | |
| The Structure of Inf..> | 2018-07-02 15:54 | 41K | |
| haveliwala02topicsen..> | 2018-07-02 15:54 | 260K | |
| hypersearching_web.html | 2018-07-02 15:54 | 26K | |
| intelligent_surfer_i..> | 2018-07-02 15:54 | 387K | |
| minhash.ppt | 2018-07-02 15:54 | 56K | |
| p437-olstonA4.pdf | 2018-07-02 15:54 | 639K | |
| paper215.pdf | 2018-07-02 15:54 | 154K | |
| powerlaw_internet_to..> | 2018-07-02 15:54 | 451K | |
| www9 paper.html | 2018-07-02 15:54 | 56K | |
| markov chains/ | 2018-07-02 15:54 | - | |
| www9 paper_files/ | 2018-07-02 15:54 | - | |
| ~$minhash.ppt | 2020-02-17 20:17 | 165 | |
| paper_IRLbot.pdf | 2020-02-24 12:00 | 732K | |
| paper_crawl_longevit..> | 2020-02-24 12:00 | 639K | |
| paper_near_duplicate..> | 2020-02-24 12:00 | 154K | |
| paper_powerlaw_inter..> | 2020-02-24 12:00 | 451K | |